About 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid
3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid (PubChem CID 87287861) has the molecular formula C22H18N4O7S2
and a molecular weight of 514.54 g/mol. Its IUPAC name is 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid.
Molecular Properties
| Compound Name | 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid |
| PubChem CID | 87287861 |
| Molecular Formula | C22H18N4O7S2 |
| Molecular Weight | 514.54 g/mol |
| Exact Mass | 514.06 |
| IUPAC Name | 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid |
| SMILES | O=S(=O)(O)C1c2ccccc2C=C(O)C1(/N=N/c1ccc(/N=N/c2ccccc2)cc1)S(=O)(=O)O |
| InChI | InChI=1S/C22H18N4O7S2/c27-20-14-15-6-4-5-9-19(15)21(34(28,29)30)22(20,35(31,32)33)26-25-18-12-10-17(11-13-18)24-23-16-7-2-1-3-8-16/h1-14,21,27H,(H,28,29,30)(H,31,32,33)/b24-23+,26-25+ |
| InChIKey | MXHPLDJKBDDIJZ-QSZPNPOGSA-N |
| XLogP | 5.31 |
| TPSA | 178.41 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 514.54 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid?
The IUPAC name of 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid (CID 87287861) is 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid.
What is the SMILES notation for 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid?
The canonical SMILES for 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid is O=S(=O)(O)C1c2ccccc2C=C(O)C1(/N=N/c1ccc(/N=N/c2ccccc2)cc1)S(=O)(=O)O.
What is the InChIKey of 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid?
The InChIKey is MXHPLDJKBDDIJZ-QSZPNPOGSA-N. The full InChI is InChI=1S/C22H18N4O7S2/c27-20-14-15-6-4-5-9-19(15)21(34(28,29)30)22(20,35(31,32)33)26-25-18-12-10-17(11-13-18)24-23-16-7-2-1-3-8-16/h1-14,21,27H,(H,28,29,30)(H,31,32,33)/b24-23+,26-25+.
What are the key properties of 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid?
3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid has a molecular weight of 514.54 g/mol, XLogP of 5.31, 6 rotatable bonds, 3 hydrogen bond donors, and 9 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2-[(4-phenyldiazenylphenyl)diazenyl]-1H-naphthalene-1,2-disulfonic acid is sourced from PubChem (CID 87287861), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).