C12H10F13N2+ — CID 87287947
1-methyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)imidazol-1-ium (PubChem CID 87287947) has the molecular formula C12H10F13N2+ and a molecular weight of 429.20 g/mol. Its IUPAC name is 1-methyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)imidazol-1-ium.
| Compound Name | 1-methyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)imidazol-1-ium |
|---|---|
| PubChem CID | 87287947 |
| Molecular Formula | C12H10F13N2+ |
| Molecular Weight | 429.20 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 1-methyl-1-(1,1,2,2,3,3,4,4,5,5,6,6,7-tridecafluorooctyl)imidazol-1-ium |
| SMILES | CC(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)[N+]1(C)C=CN=C1 |
| InChI | InChI=1S/C12H10F13N2/c1-6(13)7(14,15)8(16,17)9(18,19)10(20,21)11(22,23)12(24,25)27(2)4-3-26-5-27/h3-6H,1-2H3/q+1 |
| InChIKey | OMKYDBJHLAJZLF-UHFFFAOYSA-N |
| XLogP | 5.07 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.20 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|