C12H9F13N2 — CID 87287948
1-methyl-2-(1,2,2,3,3,4,4,5,5,6,7,8,8-tridecafluorooctyl)imidazole (PubChem CID 87287948) has the molecular formula C12H9F13N2 and a molecular weight of 428.19 g/mol. Its IUPAC name is 1-methyl-2-(1,2,2,3,3,4,4,5,5,6,7,8,8-tridecafluorooctyl)imidazole.
| Compound Name | 1-methyl-2-(1,2,2,3,3,4,4,5,5,6,7,8,8-tridecafluorooctyl)imidazole |
|---|---|
| PubChem CID | 87287948 |
| Molecular Formula | C12H9F13N2 |
| Molecular Weight | 428.19 g/mol |
| Exact Mass | 428.06 |
| IUPAC Name | 1-methyl-2-(1,2,2,3,3,4,4,5,5,6,7,8,8-tridecafluorooctyl)imidazole |
| SMILES | Cn1ccnc1C(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)C(F)C(F)F |
| InChI | InChI=1S/C12H9F13N2/c1-27-3-2-26-8(27)6(15)10(20,21)12(24,25)11(22,23)9(18,19)5(14)4(13)7(16)17/h2-7H,1H3 |
| InChIKey | BGZKKFYWCYVWCH-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.19 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|