C20H17Cl2F3N6O4S — CID 87287991
[2,4-dichloro-6-[[4-[(7-methoxy-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)carbamoyl]piperazin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate (PubChem CID 87287991) has the molecular formula C20H17Cl2F3N6O4S and a molecular weight of 565.36 g/mol. Its IUPAC name is [2,4-dichloro-6-[[4-[(7-methoxy-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)carbamoyl]piperazin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate.
| Compound Name | [2,4-dichloro-6-[[4-[(7-methoxy-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)carbamoyl]piperazin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate |
|---|---|
| PubChem CID | 87287991 |
| Molecular Formula | C20H17Cl2F3N6O4S |
| Molecular Weight | 565.36 g/mol |
| Exact Mass | 564.04 |
| IUPAC Name | [2,4-dichloro-6-[[4-[(7-methoxy-[1,3]thiazolo[5,4-d]pyrimidin-2-yl)carbamoyl]piperazin-1-yl]methyl]phenyl] 2,2,2-trifluoroacetate |
| SMILES | COc1ncnc2sc(NC(=O)N3CCN(Cc4cc(Cl)cc(Cl)c4OC(=O)C(F)(F)F)CC3)nc12 |
| InChI | InChI=1S/C20H17Cl2F3N6O4S/c1-34-15-13-16(27-9-26-15)36-18(28-13)29-19(33)31-4-2-30(3-5-31)8-10-6-11(21)7-12(22)14(10)35-17(32)20(23,24)25/h6-7,9H,2-5,8H2,1H3,(H,28,29,33) |
| InChIKey | DCIIJXGLAQTOOF-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 109.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.36 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|