C23H21BrClF3N2O3S — CID 87288264
(2,2,2-trifluoroacetyl) (2R,3R,4R,5S)-4-(4-bromothiophen-2-yl)-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate (PubChem CID 87288264) has the molecular formula C23H21BrClF3N2O3S and a molecular weight of 577.85 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) (2R,3R,4R,5S)-4-(4-bromothiophen-2-yl)-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate.
| Compound Name | (2,2,2-trifluoroacetyl) (2R,3R,4R,5S)-4-(4-bromothiophen-2-yl)-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
|---|---|
| PubChem CID | 87288264 |
| Molecular Formula | C23H21BrClF3N2O3S |
| Molecular Weight | 577.85 g/mol |
| Exact Mass | 576.01 |
| IUPAC Name | (2,2,2-trifluoroacetyl) (2R,3R,4R,5S)-4-(4-bromothiophen-2-yl)-3-(3-chlorophenyl)-4-cyano-5-(2,2-dimethylpropyl)pyrrolidine-2-carboxylate |
| SMILES | CC(C)(C)C[C@@H]1N[C@@H](C(=O)OC(=O)C(F)(F)F)[C@H](c2cccc(Cl)c2)[C@@]1(C#N)c1cc(Br)cs1 |
| InChI | InChI=1S/C23H21BrClF3N2O3S/c1-21(2,3)9-15-22(11-29,16-8-13(24)10-34-16)17(12-5-4-6-14(25)7-12)18(30-15)19(31)33-20(32)23(26,27)28/h4-8,10,15,17-18,30H,9H2,1-3H3/t15-,17-,18+,22+/m0/s1 |
| InChIKey | OBWPNHDFGABDLM-CTWQGKMFSA-N |
| XLogP | 6.12 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.85 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|