C49H41BF4N2 — CID 87288354
(2S,5S)-1-[[(2S,5S)-2,5-dinaphthalen-1-ylpyrrolidin-1-ium-1-ylidene]methyl]-2,5-dinaphthalen-1-ylpyrrolidine tetrafluoroborate (PubChem CID 87288354) has the molecular formula C49H41BF4N2 and a molecular weight of 744.69 g/mol. Its IUPAC name is (2S,5S)-1-[[(2S,5S)-2,5-dinaphthalen-1-ylpyrrolidin-1-ium-1-ylidene]methyl]-2,5-dinaphthalen-1-ylpyrrolidine tetrafluoroborate.
| Compound Name | (2S,5S)-1-[[(2S,5S)-2,5-dinaphthalen-1-ylpyrrolidin-1-ium-1-ylidene]methyl]-2,5-dinaphthalen-1-ylpyrrolidine tetrafluoroborate |
|---|---|
| PubChem CID | 87288354 |
| Molecular Formula | C49H41BF4N2 |
| Molecular Weight | 744.69 g/mol |
| Exact Mass | 744.33 |
| IUPAC Name | (2S,5S)-1-[[(2S,5S)-2,5-dinaphthalen-1-ylpyrrolidin-1-ium-1-ylidene]methyl]-2,5-dinaphthalen-1-ylpyrrolidine tetrafluoroborate |
| SMILES | C(N1[C@H](c2cccc3ccccc23)CC[C@H]1c1cccc2ccccc12)=[N+]1[C@H](c2cccc3ccccc23)CC[C@H]1c1cccc2ccccc12.F[B-](F)(F)F |
| InChI | InChI=1S/C49H41N2.BF4/c1-5-21-38-34(13-1)17-9-25-42(38)46-29-30-47(43-26-10-18-35-14-2-6-22-39(35)43)50(46)33-51-48(44-27-11-19-36-15-3-7-23-40(36)44)31-32-49(51)45-28-12-20-37-16-4-8-24-41(37)45;2-1(3,4)5/h1-28,33,46-49H,29-32H2;/q+1;-1/t46-,47-,48-,49-;/m0./s1 |
| InChIKey | XXGMQSFVTWBKDE-VWENUQMXSA-N |
| XLogP | 13.79 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 744.69 |
| LogP ≤ 5 | 13.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|