C25H13BrF13N3O2 — CID 87288855
2-bromo-N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-bis(trifluoromethyl)phenyl]carbamoyl]phenyl]-N-methylpyridine-3-carboxamide (PubChem CID 87288855) has the molecular formula C25H13BrF13N3O2 and a molecular weight of 714.28 g/mol. Its IUPAC name is 2-bromo-N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-bis(trifluoromethyl)phenyl]carbamoyl]phenyl]-N-methylpyridine-3-carboxamide.
| Compound Name | 2-bromo-N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-bis(trifluoromethyl)phenyl]carbamoyl]phenyl]-N-methylpyridine-3-carboxamide |
|---|---|
| PubChem CID | 87288855 |
| Molecular Formula | C25H13BrF13N3O2 |
| Molecular Weight | 714.28 g/mol |
| Exact Mass | 713.00 |
| IUPAC Name | 2-bromo-N-[3-[[4-(1,1,1,2,3,3,3-heptafluoropropan-2-yl)-2,6-bis(trifluoromethyl)phenyl]carbamoyl]phenyl]-N-methylpyridine-3-carboxamide |
| SMILES | CN(C(=O)c1cccnc1Br)c1cccc(C(=O)Nc2c(C(F)(F)F)cc(C(F)(C(F)(F)F)C(F)(F)F)cc2C(F)(F)F)c1 |
| InChI | InChI=1S/C25H13BrF13N3O2/c1-42(20(44)14-6-3-7-40-18(14)26)13-5-2-4-11(8-13)19(43)41-17-15(22(28,29)30)9-12(10-16(17)23(31,32)33)21(27,24(34,35)36)25(37,38)39/h2-10H,1H3,(H,41,43) |
| InChIKey | LJYAZHAQRKGGOA-UHFFFAOYSA-N |
| XLogP | 8.70 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 714.28 |
| LogP ≤ 5 | 8.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|