About benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium
benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium (PubChem CID 87289195) has the molecular formula C38H39BIO3+
and a molecular weight of 681.44 g/mol. Its IUPAC name is benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium.
Molecular Properties
| Compound Name | benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium |
| PubChem CID | 87289195 |
| Molecular Formula | C38H39BIO3+ |
| Molecular Weight | 681.44 g/mol |
| Exact Mass | 681.20 |
| IUPAC Name | benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium |
| SMILES | CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.OB(O)Oc1cccc2ccc3cc4ccccc4cc3c12 |
| InChI | InChI=1S/C20H26I.C18H13BO3/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;20-19(21)22-17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17/h7-14H,1-6H3;1-11,20-21H/q+1; |
| InChIKey | UDPBXZLAPUMAJP-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 681.44 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium?
The IUPAC name of benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium (CID 87289195) is benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium.
What is the SMILES notation for benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium?
The canonical SMILES for benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium is CC(C)(C)c1ccc([I+]c2ccc(C(C)(C)C)cc2)cc1.OB(O)Oc1cccc2ccc3cc4ccccc4cc3c12.
What is the InChIKey of benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium?
The InChIKey is UDPBXZLAPUMAJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H26I.C18H13BO3/c1-19(2,3)15-7-11-17(12-8-15)21-18-13-9-16(10-14-18)20(4,5)6;20-19(21)22-17-7-3-6-12-8-9-15-10-13-4-1-2-5-14(13)11-16(15)18(12)17/h7-14H,1-6H3;1-11,20-21H/q+1;.
What are the key properties of benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium?
benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium has a molecular weight of 681.44 g/mol, XLogP of 5.90, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[a]anthracen-1-yloxyboronic acid;bis(4-tert-butylphenyl)iodanium is sourced from PubChem (CID 87289195), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).