About (Z)-3,4-dibromobut-3-enal
(Z)-3,4-dibromobut-3-enal (PubChem CID 87289323) has the molecular formula C4H4Br2O
and a molecular weight of 227.88 g/mol. Its IUPAC name is (Z)-3,4-dibromobut-3-enal.
Molecular Properties
| Compound Name | (Z)-3,4-dibromobut-3-enal |
| PubChem CID | 87289323 |
| Molecular Formula | C4H4Br2O |
| Molecular Weight | 227.88 g/mol |
| Exact Mass | 225.86 |
| IUPAC Name | (Z)-3,4-dibromobut-3-enal |
| SMILES | O=CC/C(Br)=C/Br |
| InChI | InChI=1S/C4H4Br2O/c5-3-4(6)1-2-7/h2-3H,1H2/b4-3- |
| InChIKey | AYURWXGOHSIVLR-ARJAWSKDSA-N |
| XLogP | 2.21 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.88 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,4-dibromobut-3-enal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-dibromobut-3-enal?
The IUPAC name of (Z)-3,4-dibromobut-3-enal (CID 87289323) is (Z)-3,4-dibromobut-3-enal.
What is the SMILES notation for (Z)-3,4-dibromobut-3-enal?
The canonical SMILES for (Z)-3,4-dibromobut-3-enal is O=CC/C(Br)=C/Br.
What is the InChIKey of (Z)-3,4-dibromobut-3-enal?
The InChIKey is AYURWXGOHSIVLR-ARJAWSKDSA-N. The full InChI is InChI=1S/C4H4Br2O/c5-3-4(6)1-2-7/h2-3H,1H2/b4-3-.
What are the key properties of (Z)-3,4-dibromobut-3-enal?
(Z)-3,4-dibromobut-3-enal has a molecular weight of 227.88 g/mol, XLogP of 2.21, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-dibromobut-3-enal is sourced from PubChem (CID 87289323), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).