About (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate
(1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate (PubChem CID 87289460) has the molecular formula C15H19ClFN3O3
and a molecular weight of 343.79 g/mol. Its IUPAC name is (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate.
Molecular Properties
| Compound Name | (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate |
| PubChem CID | 87289460 |
| Molecular Formula | C15H19ClFN3O3 |
| Molecular Weight | 343.79 g/mol |
| Exact Mass | 343.11 |
| IUPAC Name | (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate |
| SMILES | Cc1c(Cl)ncnc1O[C@H]1CCN(C(=O)OC2(C)CC2)CC1F |
| InChI | InChI=1S/C15H19ClFN3O3/c1-9-12(16)18-8-19-13(9)22-11-3-6-20(7-10(11)17)14(21)23-15(2)4-5-15/h8,10-11H,3-7H2,1-2H3/t10?,11-/m0/s1 |
| InChIKey | WQYIRFXWUHVWGR-DTIOYNMSSA-N |
| XLogP | 2.92 |
| TPSA | 64.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.79 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate?
The IUPAC name of (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate (CID 87289460) is (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate.
What is the SMILES notation for (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate?
The canonical SMILES for (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate is Cc1c(Cl)ncnc1O[C@H]1CCN(C(=O)OC2(C)CC2)CC1F.
What is the InChIKey of (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate?
The InChIKey is WQYIRFXWUHVWGR-DTIOYNMSSA-N. The full InChI is InChI=1S/C15H19ClFN3O3/c1-9-12(16)18-8-19-13(9)22-11-3-6-20(7-10(11)17)14(21)23-15(2)4-5-15/h8,10-11H,3-7H2,1-2H3/t10?,11-/m0/s1.
What are the key properties of (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate?
(1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate has a molecular weight of 343.79 g/mol, XLogP of 2.92, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopropyl) (4S)-4-(6-chloro-5-methylpyrimidin-4-yl)oxy-3-fluoropiperidine-1-carboxylate is sourced from PubChem (CID 87289460), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).