C24H24F4O4S2 — CID 87290002
1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate;triphenylsulfanium (PubChem CID 87290002) has the molecular formula C24H24F4O4S2 and a molecular weight of 516.58 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate;triphenylsulfanium.
| Compound Name | 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate;triphenylsulfanium |
|---|---|
| PubChem CID | 87290002 |
| Molecular Formula | C24H24F4O4S2 |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate;triphenylsulfanium |
| SMILES | O=S(=O)([O-])C(F)(F)C(F)(F)CCCCO.c1ccc([S+](c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15S.C6H10F4O4S/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;7-5(8,3-1-2-4-11)6(9,10)15(12,13)14/h1-15H;11H,1-4H2,(H,12,13,14)/q+1;/p-1 |
| InChIKey | SJKLDVQCMFSWPK-UHFFFAOYSA-M |
| XLogP | 5.70 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|