C24H24F4O4S2 — CID 87290003
(triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate (PubChem CID 87290003) has the molecular formula C24H24F4O4S2 and a molecular weight of 516.58 g/mol. Its IUPAC name is (triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate.
| Compound Name | (triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate |
|---|---|
| PubChem CID | 87290003 |
| Molecular Formula | C24H24F4O4S2 |
| Molecular Weight | 516.58 g/mol |
| Exact Mass | 516.11 |
| IUPAC Name | (triphenyl-λ4-sulfanyl) 1,1,2,2-tetrafluoro-6-hydroxyhexane-1-sulfonate |
| SMILES | O=S(=O)(OS(c1ccccc1)(c1ccccc1)c1ccccc1)C(F)(F)C(F)(F)CCCCO |
| InChI | InChI=1S/C24H24F4O4S2/c25-23(26,18-10-11-19-29)24(27,28)34(30,31)32-33(20-12-4-1-5-13-20,21-14-6-2-7-15-21)22-16-8-3-9-17-22/h1-9,12-17,29H,10-11,18-19H2 |
| InChIKey | CYTXFNBPIZRDGF-UHFFFAOYSA-N |
| XLogP | 6.62 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.58 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|