C17H14BrF3N4O3S — CID 87290006
N-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2,3,6-trifluoro-5-(propylsulfonylamino)benzamide (PubChem CID 87290006) has the molecular formula C17H14BrF3N4O3S and a molecular weight of 491.29 g/mol. Its IUPAC name is N-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2,3,6-trifluoro-5-(propylsulfonylamino)benzamide.
| Compound Name | N-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2,3,6-trifluoro-5-(propylsulfonylamino)benzamide |
|---|---|
| PubChem CID | 87290006 |
| Molecular Formula | C17H14BrF3N4O3S |
| Molecular Weight | 491.29 g/mol |
| Exact Mass | 489.99 |
| IUPAC Name | N-(3-bromo-1H-pyrrolo[2,3-b]pyridin-5-yl)-2,3,6-trifluoro-5-(propylsulfonylamino)benzamide |
| SMILES | CCCS(=O)(=O)Nc1cc(F)c(F)c(C(=O)Nc2cnc3[nH]cc(Br)c3c2)c1F |
| InChI | InChI=1S/C17H14BrF3N4O3S/c1-2-3-29(27,28)25-12-5-11(19)14(20)13(15(12)21)17(26)24-8-4-9-10(18)7-23-16(9)22-6-8/h4-7,25H,2-3H2,1H3,(H,22,23)(H,24,26) |
| InChIKey | WFGXFJKXNGPZNL-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 103.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.29 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|