C11H12F8 — CID 87290036
5-tert-butyl-1,3,3,4,4,5,6,6-octafluoro-2-methylcyclohexene (PubChem CID 87290036) has the molecular formula C11H12F8 and a molecular weight of 296.20 g/mol. Its IUPAC name is 5-tert-butyl-1,3,3,4,4,5,6,6-octafluoro-2-methylcyclohexene.
| Compound Name | 5-tert-butyl-1,3,3,4,4,5,6,6-octafluoro-2-methylcyclohexene |
|---|---|
| PubChem CID | 87290036 |
| Molecular Formula | C11H12F8 |
| Molecular Weight | 296.20 g/mol |
| Exact Mass | 296.08 |
| IUPAC Name | 5-tert-butyl-1,3,3,4,4,5,6,6-octafluoro-2-methylcyclohexene |
| SMILES | CC1=C(F)C(F)(F)C(F)(C(C)(C)C)C(F)(F)C1(F)F |
| InChI | InChI=1S/C11H12F8/c1-5-6(12)9(15,16)10(17,7(2,3)4)11(18,19)8(5,13)14/h1-4H3 |
| InChIKey | RNIGQZOPMWDONP-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.20 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|