About platinum;trans-(1R,2R)-cyclopentane-1,2-diamine
platinum;trans-(1R,2R)-cyclopentane-1,2-diamine (PubChem CID 87290141) has the molecular formula C5H12N2Pt
and a molecular weight of 295.24 g/mol. Its IUPAC name is platinum;trans-(1R,2R)-cyclopentane-1,2-diamine.
Molecular Properties
| Compound Name | platinum;trans-(1R,2R)-cyclopentane-1,2-diamine |
| PubChem CID | 87290141 |
| Molecular Formula | C5H12N2Pt |
| Molecular Weight | 295.24 g/mol |
| Exact Mass | 295.06 |
| IUPAC Name | platinum;trans-(1R,2R)-cyclopentane-1,2-diamine |
| SMILES | N[C@@H]1CCC[C@H]1N.[Pt] |
| InChI | InChI=1S/C5H12N2.Pt/c6-4-2-1-3-5(4)7;/h4-5H,1-3,6-7H2;/t4-,5-;/m1./s1 |
| InChIKey | VBAAWBOPDARHOA-TYSVMGFPSA-N |
| XLogP | -0.18 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.24 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze platinum;trans-(1R,2R)-cyclopentane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of platinum;trans-(1R,2R)-cyclopentane-1,2-diamine?
The IUPAC name of platinum;trans-(1R,2R)-cyclopentane-1,2-diamine (CID 87290141) is platinum;trans-(1R,2R)-cyclopentane-1,2-diamine.
What is the SMILES notation for platinum;trans-(1R,2R)-cyclopentane-1,2-diamine?
The canonical SMILES for platinum;trans-(1R,2R)-cyclopentane-1,2-diamine is N[C@@H]1CCC[C@H]1N.[Pt].
What is the InChIKey of platinum;trans-(1R,2R)-cyclopentane-1,2-diamine?
The InChIKey is VBAAWBOPDARHOA-TYSVMGFPSA-N. The full InChI is InChI=1S/C5H12N2.Pt/c6-4-2-1-3-5(4)7;/h4-5H,1-3,6-7H2;/t4-,5-;/m1./s1.
What are the key properties of platinum;trans-(1R,2R)-cyclopentane-1,2-diamine?
platinum;trans-(1R,2R)-cyclopentane-1,2-diamine has a molecular weight of 295.24 g/mol, XLogP of -0.18, 0 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for platinum;trans-(1R,2R)-cyclopentane-1,2-diamine is sourced from PubChem (CID 87290141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).