C16H15ClN2O2S2 — CID 87290241
4-chloro-N-(4-propan-2-ylphenyl)thieno[3,2-c]pyridine-2-sulfonamide (PubChem CID 87290241) has the molecular formula C16H15ClN2O2S2 and a molecular weight of 366.90 g/mol. Its IUPAC name is 4-chloro-N-(4-propan-2-ylphenyl)thieno[3,2-c]pyridine-2-sulfonamide.
| Compound Name | 4-chloro-N-(4-propan-2-ylphenyl)thieno[3,2-c]pyridine-2-sulfonamide |
|---|---|
| PubChem CID | 87290241 |
| Molecular Formula | C16H15ClN2O2S2 |
| Molecular Weight | 366.90 g/mol |
| Exact Mass | 366.03 |
| IUPAC Name | 4-chloro-N-(4-propan-2-ylphenyl)thieno[3,2-c]pyridine-2-sulfonamide |
| SMILES | CC(C)c1ccc(NS(=O)(=O)c2cc3c(Cl)nccc3s2)cc1 |
| InChI | InChI=1S/C16H15ClN2O2S2/c1-10(2)11-3-5-12(6-4-11)19-23(20,21)15-9-13-14(22-15)7-8-18-16(13)17/h3-10,19H,1-2H3 |
| InChIKey | MHTYYIYYYCKRKX-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.90 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|