About benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate
benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate (PubChem CID 87290391) has the molecular formula C20H20FNO4
and a molecular weight of 357.38 g/mol. Its IUPAC name is benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
| PubChem CID | 87290391 |
| Molecular Formula | C20H20FNO4 |
| Molecular Weight | 357.38 g/mol |
| Exact Mass | 357.14 |
| IUPAC Name | benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate |
| SMILES | O=C(OC(=O)N1C[C@H](F)C[C@@H]1COCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C20H20FNO4/c21-17-11-18(14-25-13-15-7-3-1-4-8-15)22(12-17)20(24)26-19(23)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18-/m1/s1 |
| InChIKey | WWYPNEDZVIRLNV-QZTJIDSGSA-N |
| XLogP | 3.59 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 357.38 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate?
The IUPAC name of benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate (CID 87290391) is benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate.
What is the SMILES notation for benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate?
The canonical SMILES for benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate is O=C(OC(=O)N1C[C@H](F)C[C@@H]1COCc1ccccc1)c1ccccc1.
What is the InChIKey of benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate?
The InChIKey is WWYPNEDZVIRLNV-QZTJIDSGSA-N. The full InChI is InChI=1S/C20H20FNO4/c21-17-11-18(14-25-13-15-7-3-1-4-8-15)22(12-17)20(24)26-19(23)16-9-5-2-6-10-16/h1-10,17-18H,11-14H2/t17-,18-/m1/s1.
What are the key properties of benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate?
benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate has a molecular weight of 357.38 g/mol, XLogP of 3.59, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for benzoyl (2R,4R)-4-fluoro-2-(phenylmethoxymethyl)pyrrolidine-1-carboxylate is sourced from PubChem (CID 87290391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).