C36H36N4O4 — CID 87290439
10,11-bis[2-(diethylamino)ethyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone (PubChem CID 87290439) has the molecular formula C36H36N4O4 and a molecular weight of 588.71 g/mol. Its IUPAC name is 10,11-bis[2-(diethylamino)ethyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone.
| Compound Name | 10,11-bis[2-(diethylamino)ethyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
|---|---|
| PubChem CID | 87290439 |
| Molecular Formula | C36H36N4O4 |
| Molecular Weight | 588.71 g/mol |
| Exact Mass | 588.27 |
| IUPAC Name | 10,11-bis[2-(diethylamino)ethyl]-7,18-diazaheptacyclo[14.6.2.22,5.03,12.04,9.013,23.020,24]hexacosa-1(23),2,4,9,11,13,15,20(24),21,25-decaene-6,8,17,19-tetrone |
| SMILES | CCN(CC)CCc1c2c3c(ccc4c5ccc6c7c(ccc(c(c1CCN(CC)CC)c34)c75)C(=O)NC6=O)C(=O)NC2=O |
| InChI | InChI=1S/C36H36N4O4/c1-5-39(6-2)17-15-21-22(16-18-40(7-3)8-4)32-31-26(35(43)38-36(32)44)13-10-20-19-9-12-24-29-25(34(42)37-33(24)41)14-11-23(27(19)29)28(21)30(20)31/h9-14H,5-8,15-18H2,1-4H3,(H,37,41,42)(H,38,43,44) |
| InChIKey | IUFFFESOSTYWMV-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.71 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|