C14H13N3O3 — CID 872905
2,4-dihydroxy-N-(1-pyridin-2-ylethylideneamino)benzamide (PubChem CID 872905) has the molecular formula C14H13N3O3 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2,4-dihydroxy-N-(1-pyridin-2-ylethylideneamino)benzamide.
| Compound Name | 2,4-dihydroxy-N-(1-pyridin-2-ylethylideneamino)benzamide |
|---|---|
| PubChem CID | 872905 |
| Molecular Formula | C14H13N3O3 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2,4-dihydroxy-N-(1-pyridin-2-ylethylideneamino)benzamide |
| SMILES | CC(=NNC(=O)c1ccc(O)cc1O)c1ccccn1 |
| InChI | InChI=1S/C14H13N3O3/c1-9(12-4-2-3-7-15-12)16-17-14(20)11-6-5-10(18)8-13(11)19/h2-8,18-19H,1H3,(H,17,20) |
| InChIKey | KXAAZOQRVNKROS-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 94.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|