About 3-methoxy-6,7-dimethyloctanal
3-methoxy-6,7-dimethyloctanal (PubChem CID 87290831) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 3-methoxy-6,7-dimethyloctanal.
Molecular Properties
| Compound Name | 3-methoxy-6,7-dimethyloctanal |
| PubChem CID | 87290831 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 3-methoxy-6,7-dimethyloctanal |
| SMILES | COC(CC=O)CCC(C)C(C)C |
| InChI | InChI=1S/C11H22O2/c1-9(2)10(3)5-6-11(13-4)7-8-12/h8-11H,5-7H2,1-4H3 |
| InChIKey | BQPNKOAABKESPJ-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-methoxy-6,7-dimethyloctanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-6,7-dimethyloctanal?
The IUPAC name of 3-methoxy-6,7-dimethyloctanal (CID 87290831) is 3-methoxy-6,7-dimethyloctanal.
What is the SMILES notation for 3-methoxy-6,7-dimethyloctanal?
The canonical SMILES for 3-methoxy-6,7-dimethyloctanal is COC(CC=O)CCC(C)C(C)C.
What is the InChIKey of 3-methoxy-6,7-dimethyloctanal?
The InChIKey is BQPNKOAABKESPJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-9(2)10(3)5-6-11(13-4)7-8-12/h8-11H,5-7H2,1-4H3.
What are the key properties of 3-methoxy-6,7-dimethyloctanal?
3-methoxy-6,7-dimethyloctanal has a molecular weight of 186.29 g/mol, XLogP of 2.66, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-6,7-dimethyloctanal is sourced from PubChem (CID 87290831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).