About (E)-5-methoxy-6,6-dimethylhept-3-en-2-one
(E)-5-methoxy-6,6-dimethylhept-3-en-2-one (PubChem CID 87291648) has the molecular formula C10H18O2
and a molecular weight of 170.25 g/mol. Its IUPAC name is (E)-5-methoxy-6,6-dimethylhept-3-en-2-one.
Molecular Properties
| Compound Name | (E)-5-methoxy-6,6-dimethylhept-3-en-2-one |
| PubChem CID | 87291648 |
| Molecular Formula | C10H18O2 |
| Molecular Weight | 170.25 g/mol |
| Exact Mass | 170.13 |
| IUPAC Name | (E)-5-methoxy-6,6-dimethylhept-3-en-2-one |
| SMILES | COC(/C=C/C(C)=O)C(C)(C)C |
| InChI | InChI=1S/C10H18O2/c1-8(11)6-7-9(12-5)10(2,3)4/h6-7,9H,1-5H3/b7-6+ |
| InChIKey | MKFIIDYPEDIFCN-VOTSOKGWSA-N |
| XLogP | 2.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-methoxy-6,6-dimethylhept-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-methoxy-6,6-dimethylhept-3-en-2-one?
The IUPAC name of (E)-5-methoxy-6,6-dimethylhept-3-en-2-one (CID 87291648) is (E)-5-methoxy-6,6-dimethylhept-3-en-2-one.
What is the SMILES notation for (E)-5-methoxy-6,6-dimethylhept-3-en-2-one?
The canonical SMILES for (E)-5-methoxy-6,6-dimethylhept-3-en-2-one is COC(/C=C/C(C)=O)C(C)(C)C.
What is the InChIKey of (E)-5-methoxy-6,6-dimethylhept-3-en-2-one?
The InChIKey is MKFIIDYPEDIFCN-VOTSOKGWSA-N. The full InChI is InChI=1S/C10H18O2/c1-8(11)6-7-9(12-5)10(2,3)4/h6-7,9H,1-5H3/b7-6+.
What are the key properties of (E)-5-methoxy-6,6-dimethylhept-3-en-2-one?
(E)-5-methoxy-6,6-dimethylhept-3-en-2-one has a molecular weight of 170.25 g/mol, XLogP of 2.19, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-methoxy-6,6-dimethylhept-3-en-2-one is sourced from PubChem (CID 87291648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).