About (E)-5-methoxy-5,8-dimethylnon-3-en-2-one
(E)-5-methoxy-5,8-dimethylnon-3-en-2-one (PubChem CID 87291674) has the molecular formula C12H22O2
and a molecular weight of 198.31 g/mol. Its IUPAC name is (E)-5-methoxy-5,8-dimethylnon-3-en-2-one.
Molecular Properties
| Compound Name | (E)-5-methoxy-5,8-dimethylnon-3-en-2-one |
| PubChem CID | 87291674 |
| Molecular Formula | C12H22O2 |
| Molecular Weight | 198.31 g/mol |
| Exact Mass | 198.16 |
| IUPAC Name | (E)-5-methoxy-5,8-dimethylnon-3-en-2-one |
| SMILES | COC(C)(/C=C/C(C)=O)CCC(C)C |
| InChI | InChI=1S/C12H22O2/c1-10(2)6-8-12(4,14-5)9-7-11(3)13/h7,9-10H,6,8H2,1-5H3/b9-7+ |
| InChIKey | SQFVBQPEEPLHNA-VQHVLOKHSA-N |
| XLogP | 2.97 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.31 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-5-methoxy-5,8-dimethylnon-3-en-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-5-methoxy-5,8-dimethylnon-3-en-2-one?
The IUPAC name of (E)-5-methoxy-5,8-dimethylnon-3-en-2-one (CID 87291674) is (E)-5-methoxy-5,8-dimethylnon-3-en-2-one.
What is the SMILES notation for (E)-5-methoxy-5,8-dimethylnon-3-en-2-one?
The canonical SMILES for (E)-5-methoxy-5,8-dimethylnon-3-en-2-one is COC(C)(/C=C/C(C)=O)CCC(C)C.
What is the InChIKey of (E)-5-methoxy-5,8-dimethylnon-3-en-2-one?
The InChIKey is SQFVBQPEEPLHNA-VQHVLOKHSA-N. The full InChI is InChI=1S/C12H22O2/c1-10(2)6-8-12(4,14-5)9-7-11(3)13/h7,9-10H,6,8H2,1-5H3/b9-7+.
What are the key properties of (E)-5-methoxy-5,8-dimethylnon-3-en-2-one?
(E)-5-methoxy-5,8-dimethylnon-3-en-2-one has a molecular weight of 198.31 g/mol, XLogP of 2.97, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-5-methoxy-5,8-dimethylnon-3-en-2-one is sourced from PubChem (CID 87291674), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).