About (2,2,2-trifluoroacetyl) piperidine-1-carboxylate
(2,2,2-trifluoroacetyl) piperidine-1-carboxylate (PubChem CID 87291791) has the molecular formula C8H10F3NO3
and a molecular weight of 225.17 g/mol. Its IUPAC name is (2,2,2-trifluoroacetyl) piperidine-1-carboxylate.
Molecular Properties
| Compound Name | (2,2,2-trifluoroacetyl) piperidine-1-carboxylate |
| PubChem CID | 87291791 |
| Molecular Formula | C8H10F3NO3 |
| Molecular Weight | 225.17 g/mol |
| Exact Mass | 225.06 |
| IUPAC Name | (2,2,2-trifluoroacetyl) piperidine-1-carboxylate |
| SMILES | O=C(OC(=O)C(F)(F)F)N1CCCCC1 |
| InChI | InChI=1S/C8H10F3NO3/c9-8(10,11)6(13)15-7(14)12-4-2-1-3-5-12/h1-5H2 |
| InChIKey | CWBZMPAVYNOAHW-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.17 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2,2,2-trifluoroacetyl) piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2,2,2-trifluoroacetyl) piperidine-1-carboxylate?
The IUPAC name of (2,2,2-trifluoroacetyl) piperidine-1-carboxylate (CID 87291791) is (2,2,2-trifluoroacetyl) piperidine-1-carboxylate.
What is the SMILES notation for (2,2,2-trifluoroacetyl) piperidine-1-carboxylate?
The canonical SMILES for (2,2,2-trifluoroacetyl) piperidine-1-carboxylate is O=C(OC(=O)C(F)(F)F)N1CCCCC1.
What is the InChIKey of (2,2,2-trifluoroacetyl) piperidine-1-carboxylate?
The InChIKey is CWBZMPAVYNOAHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10F3NO3/c9-8(10,11)6(13)15-7(14)12-4-2-1-3-5-12/h1-5H2.
What are the key properties of (2,2,2-trifluoroacetyl) piperidine-1-carboxylate?
(2,2,2-trifluoroacetyl) piperidine-1-carboxylate has a molecular weight of 225.17 g/mol, XLogP of 1.70, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2,2,2-trifluoroacetyl) piperidine-1-carboxylate is sourced from PubChem (CID 87291791), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).