About 3-hydroxy-2,5-dimethylheptanal
3-hydroxy-2,5-dimethylheptanal (PubChem CID 87291844) has the molecular formula C9H18O2
and a molecular weight of 158.24 g/mol. Its IUPAC name is 3-hydroxy-2,5-dimethylheptanal.
Molecular Properties
| Compound Name | 3-hydroxy-2,5-dimethylheptanal |
| PubChem CID | 87291844 |
| Molecular Formula | C9H18O2 |
| Molecular Weight | 158.24 g/mol |
| Exact Mass | 158.13 |
| IUPAC Name | 3-hydroxy-2,5-dimethylheptanal |
| SMILES | CCC(C)CC(O)C(C)C=O |
| InChI | InChI=1S/C9H18O2/c1-4-7(2)5-9(11)8(3)6-10/h6-9,11H,4-5H2,1-3H3 |
| InChIKey | VWIPDAMETWRDQD-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.24 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-hydroxy-2,5-dimethylheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-2,5-dimethylheptanal?
The IUPAC name of 3-hydroxy-2,5-dimethylheptanal (CID 87291844) is 3-hydroxy-2,5-dimethylheptanal.
What is the SMILES notation for 3-hydroxy-2,5-dimethylheptanal?
The canonical SMILES for 3-hydroxy-2,5-dimethylheptanal is CCC(C)CC(O)C(C)C=O.
What is the InChIKey of 3-hydroxy-2,5-dimethylheptanal?
The InChIKey is VWIPDAMETWRDQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18O2/c1-4-7(2)5-9(11)8(3)6-10/h6-9,11H,4-5H2,1-3H3.
What are the key properties of 3-hydroxy-2,5-dimethylheptanal?
3-hydroxy-2,5-dimethylheptanal has a molecular weight of 158.24 g/mol, XLogP of 1.62, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-2,5-dimethylheptanal is sourced from PubChem (CID 87291844), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).