About ditert-butyliodanium;trifluoromethanesulfonate
ditert-butyliodanium;trifluoromethanesulfonate (PubChem CID 87291991) has the molecular formula C9H18F3IO3S
and a molecular weight of 390.21 g/mol. Its IUPAC name is ditert-butyliodanium;trifluoromethanesulfonate.
Molecular Properties
| Compound Name | ditert-butyliodanium;trifluoromethanesulfonate |
| PubChem CID | 87291991 |
| Molecular Formula | C9H18F3IO3S |
| Molecular Weight | 390.21 g/mol |
| Exact Mass | 390.00 |
| IUPAC Name | ditert-butyliodanium;trifluoromethanesulfonate |
| SMILES | CC(C)(C)[I+]C(C)(C)C.O=S(=O)([O-])C(F)(F)F |
| InChI | InChI=1S/C8H18I.CHF3O3S/c1-7(2,3)9-8(4,5)6;2-1(3,4)8(5,6)7/h1-6H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | XVOHQJOCVZGTLI-UHFFFAOYSA-M |
| XLogP | -0.28 |
| TPSA | 57.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 390.21 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|
Analyze ditert-butyliodanium;trifluoromethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ditert-butyliodanium;trifluoromethanesulfonate?
The IUPAC name of ditert-butyliodanium;trifluoromethanesulfonate (CID 87291991) is ditert-butyliodanium;trifluoromethanesulfonate.
What is the SMILES notation for ditert-butyliodanium;trifluoromethanesulfonate?
The canonical SMILES for ditert-butyliodanium;trifluoromethanesulfonate is CC(C)(C)[I+]C(C)(C)C.O=S(=O)([O-])C(F)(F)F.
What is the InChIKey of ditert-butyliodanium;trifluoromethanesulfonate?
The InChIKey is XVOHQJOCVZGTLI-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H18I.CHF3O3S/c1-7(2,3)9-8(4,5)6;2-1(3,4)8(5,6)7/h1-6H3;(H,5,6,7)/q+1;/p-1.
What are the key properties of ditert-butyliodanium;trifluoromethanesulfonate?
ditert-butyliodanium;trifluoromethanesulfonate has a molecular weight of 390.21 g/mol, XLogP of -0.28, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ditert-butyliodanium;trifluoromethanesulfonate is sourced from PubChem (CID 87291991), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).