About cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium
cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium (PubChem CID 87292246) has the molecular formula C8H8F3N3OS2
and a molecular weight of 283.30 g/mol. Its IUPAC name is cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium.
Molecular Properties
| Compound Name | cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium |
| PubChem CID | 87292246 |
| Molecular Formula | C8H8F3N3OS2 |
| Molecular Weight | 283.30 g/mol |
| Exact Mass | 283.01 |
| IUPAC Name | cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium |
| SMILES | CC(c1cnc(C(F)(F)F)s1)/S([O-])=[N+](\C)C#N |
| InChI | InChI=1S/C8H8F3N3OS2/c1-5(17(15)14(2)4-12)6-3-13-7(16-6)8(9,10)11/h3,5H,1-2H3 |
| InChIKey | YRASEBKVOVQOCM-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 62.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 283.30 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium?
The IUPAC name of cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium (CID 87292246) is cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium.
What is the SMILES notation for cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium?
The canonical SMILES for cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium is CC(c1cnc(C(F)(F)F)s1)/S([O-])=[N+](\C)C#N.
What is the InChIKey of cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium?
The InChIKey is YRASEBKVOVQOCM-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H8F3N3OS2/c1-5(17(15)14(2)4-12)6-3-13-7(16-6)8(9,10)11/h3,5H,1-2H3.
What are the key properties of cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium?
cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium has a molecular weight of 283.30 g/mol, XLogP of 2.28, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for cyano-methyl-[oxido-[1-[2-(trifluoromethyl)-1,3-thiazol-5-yl]ethyl]-λ4-sulfanylidene]azanium is sourced from PubChem (CID 87292246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).