About tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate
tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate (PubChem CID 87292388) has the molecular formula C66H87O4P
and a molecular weight of 975.39 g/mol. Its IUPAC name is tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate.
Molecular Properties
| Compound Name | tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate |
| PubChem CID | 87292388 |
| Molecular Formula | C66H87O4P |
| Molecular Weight | 975.39 g/mol |
| Exact Mass | 974.63 |
| IUPAC Name | tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate |
| SMILES | CC(C)(C)c1ccccc1C(C)(OP(=O)(OC(C)(c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C)OC(C)(c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C |
| InChI | InChI=1S/C66H87O4P/c1-58(2,3)46-34-22-28-40-52(46)64(19,53-41-29-23-35-47(53)59(4,5)6)68-71(67,69-65(20,54-42-30-24-36-48(54)60(7,8)9)55-43-31-25-37-49(55)61(10,11)12)70-66(21,56-44-32-26-38-50(56)62(13,14)15)57-45-33-27-39-51(57)63(16,17)18/h22-45H,1-21H3 |
| InChIKey | NNWJATPNILKEQQ-UHFFFAOYSA-N |
| XLogP | 18.82 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 71 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 975.39 |
| LogP ≤ 5 | 18.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate?
The IUPAC name of tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate (CID 87292388) is tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate.
What is the SMILES notation for tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate?
The canonical SMILES for tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate is CC(C)(C)c1ccccc1C(C)(OP(=O)(OC(C)(c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C)OC(C)(c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C)c1ccccc1C(C)(C)C.
What is the InChIKey of tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate?
The InChIKey is NNWJATPNILKEQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C66H87O4P/c1-58(2,3)46-34-22-28-40-52(46)64(19,53-41-29-23-35-47(53)59(4,5)6)68-71(67,69-65(20,54-42-30-24-36-48(54)60(7,8)9)55-43-31-25-37-49(55)61(10,11)12)70-66(21,56-44-32-26-38-50(56)62(13,14)15)57-45-33-27-39-51(57)63(16,17)18/h22-45H,1-21H3.
What are the key properties of tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate?
tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate has a molecular weight of 975.39 g/mol, XLogP of 18.82, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for tris[1,1-bis(2-tert-butylphenyl)ethyl] phosphate is sourced from PubChem (CID 87292388), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).