About 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid
3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid (PubChem CID 87293138) has the molecular formula C26H27NO6S2
and a molecular weight of 513.64 g/mol. Its IUPAC name is 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid.
Molecular Properties
| Compound Name | 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid |
| PubChem CID | 87293138 |
| Molecular Formula | C26H27NO6S2 |
| Molecular Weight | 513.64 g/mol |
| Exact Mass | 513.13 |
| IUPAC Name | 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid |
| SMILES | Cc1ccc(S(=O)(=O)O)cc1.O=S1(=O)c2ccccc2-c2ccc(O[C@@H]3CN4CCC3CC4)cc21 |
| InChI | InChI=1S/C19H19NO3S.C7H8O3S/c21-24(22)18-4-2-1-3-15(18)16-6-5-14(11-19(16)24)23-17-12-20-9-7-13(17)8-10-20;1-6-2-4-7(5-3-6)11(8,9)10/h1-6,11,13,17H,7-10,12H2;2-5H,1H3,(H,8,9,10)/t17-;/m1./s1 |
| InChIKey | DXWMJYNHKJINKT-UNTBIKODSA-N |
| XLogP | 4.21 |
| TPSA | 100.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 513.64 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid?
The IUPAC name of 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid (CID 87293138) is 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid.
What is the SMILES notation for 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid?
The canonical SMILES for 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid is Cc1ccc(S(=O)(=O)O)cc1.O=S1(=O)c2ccccc2-c2ccc(O[C@@H]3CN4CCC3CC4)cc21.
What is the InChIKey of 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid?
The InChIKey is DXWMJYNHKJINKT-UNTBIKODSA-N. The full InChI is InChI=1S/C19H19NO3S.C7H8O3S/c21-24(22)18-4-2-1-3-15(18)16-6-5-14(11-19(16)24)23-17-12-20-9-7-13(17)8-10-20;1-6-2-4-7(5-3-6)11(8,9)10/h1-6,11,13,17H,7-10,12H2;2-5H,1H3,(H,8,9,10)/t17-;/m1./s1.
What are the key properties of 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid?
3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid has a molecular weight of 513.64 g/mol, XLogP of 4.21, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[[(3S)-1-azabicyclo[2.2.2]octan-3-yl]oxy]dibenzothiophene 5,5-dioxide;4-methylbenzenesulfonic acid is sourced from PubChem (CID 87293138), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).