About oxirane;tributyl(1,3-thiazol-4-yl)stannane
oxirane;tributyl(1,3-thiazol-4-yl)stannane (PubChem CID 87293321) has the molecular formula C17H33NOSSn
and a molecular weight of 418.24 g/mol. Its IUPAC name is oxirane;tributyl(1,3-thiazol-4-yl)stannane.
Molecular Properties
| Compound Name | oxirane;tributyl(1,3-thiazol-4-yl)stannane |
| PubChem CID | 87293321 |
| Molecular Formula | C17H33NOSSn |
| Molecular Weight | 418.24 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | oxirane;tributyl(1,3-thiazol-4-yl)stannane |
| SMILES | C1CO1.CCCC[Sn](CCCC)(CCCC)c1cscn1 |
| InChI | InChI=1S/3C4H9.C3H2NS.C2H4O.Sn/c3*1-3-4-2;1-2-5-3-4-1;1-2-3-1;/h3*1,3-4H2,2H3;2-3H;1-2H2; |
| InChIKey | YBNLYAJDKWZOES-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 25.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 418.24 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze oxirane;tributyl(1,3-thiazol-4-yl)stannane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of oxirane;tributyl(1,3-thiazol-4-yl)stannane?
The IUPAC name of oxirane;tributyl(1,3-thiazol-4-yl)stannane (CID 87293321) is oxirane;tributyl(1,3-thiazol-4-yl)stannane.
What is the SMILES notation for oxirane;tributyl(1,3-thiazol-4-yl)stannane?
The canonical SMILES for oxirane;tributyl(1,3-thiazol-4-yl)stannane is C1CO1.CCCC[Sn](CCCC)(CCCC)c1cscn1.
What is the InChIKey of oxirane;tributyl(1,3-thiazol-4-yl)stannane?
The InChIKey is YBNLYAJDKWZOES-UHFFFAOYSA-N. The full InChI is InChI=1S/3C4H9.C3H2NS.C2H4O.Sn/c3*1-3-4-2;1-2-5-3-4-1;1-2-3-1;/h3*1,3-4H2,2H3;2-3H;1-2H2;.
What are the key properties of oxirane;tributyl(1,3-thiazol-4-yl)stannane?
oxirane;tributyl(1,3-thiazol-4-yl)stannane has a molecular weight of 418.24 g/mol, XLogP of 5.22, 10 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for oxirane;tributyl(1,3-thiazol-4-yl)stannane is sourced from PubChem (CID 87293321), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).