C20H21FN6O7S — CID 87293368
[(3aR,4R,6R,6aR)-4-[6-[(4-fluorobenzoyl)amino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate (PubChem CID 87293368) has the molecular formula C20H21FN6O7S and a molecular weight of 508.49 g/mol. Its IUPAC name is [(3aR,4R,6R,6aR)-4-[6-[(4-fluorobenzoyl)amino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate.
| Compound Name | [(3aR,4R,6R,6aR)-4-[6-[(4-fluorobenzoyl)amino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate |
|---|---|
| PubChem CID | 87293368 |
| Molecular Formula | C20H21FN6O7S |
| Molecular Weight | 508.49 g/mol |
| Exact Mass | 508.12 |
| IUPAC Name | [(3aR,4R,6R,6aR)-4-[6-[(4-fluorobenzoyl)amino]purin-9-yl]-2,2-dimethyl-3a,4,6,6a-tetrahydrofuro[3,4-d][1,3]dioxol-6-yl]methyl sulfamate |
| SMILES | CC1(C)O[C@@H]2[C@H](O1)[C@@H](COS(N)(=O)=O)O[C@H]2n1cnc2c(NC(=O)c3ccc(F)cc3)ncnc21 |
| InChI | InChI=1S/C20H21FN6O7S/c1-20(2)33-14-12(7-31-35(22,29)30)32-19(15(14)34-20)27-9-25-13-16(23-8-24-17(13)27)26-18(28)10-3-5-11(21)6-4-10/h3-6,8-9,12,14-15,19H,7H2,1-2H3,(H2,22,29,30)(H,23,24,26,28)/t12-,14-,15-,19-/m1/s1 |
| InChIKey | BTHCYTRCCUKQEU-QEPJRFBGSA-N |
| XLogP | 0.86 |
| TPSA | 169.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.49 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 11 |