C15H14F6O4 — CID 87293415
4-[2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexa-2,4-diene-1,1-diol (PubChem CID 87293415) has the molecular formula C15H14F6O4 and a molecular weight of 372.26 g/mol. Its IUPAC name is 4-[2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexa-2,4-diene-1,1-diol.
| Compound Name | 4-[2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexa-2,4-diene-1,1-diol |
|---|---|
| PubChem CID | 87293415 |
| Molecular Formula | C15H14F6O4 |
| Molecular Weight | 372.26 g/mol |
| Exact Mass | 372.08 |
| IUPAC Name | 4-[2-(4,4-dihydroxycyclohexa-1,5-dien-1-yl)-1,1,1,3,3,3-hexafluoropropan-2-yl]cyclohexa-2,4-diene-1,1-diol |
| SMILES | OC1(O)C=CC(C(C2=CCC(O)(O)C=C2)(C(F)(F)F)C(F)(F)F)=CC1 |
| InChI | InChI=1S/C15H14F6O4/c16-14(17,18)13(15(19,20)21,9-1-5-11(22,23)6-2-9)10-3-7-12(24,25)8-4-10/h1-5,7,22-25H,6,8H2 |
| InChIKey | HBIPMCUIQOMMFU-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.26 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|