C20H22F5N3O2S — CID 87293730
2-(2-methylsulfanylethyl)-8-(2,3,4,5,6-pentafluorobenzoyl)-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 87293730) has the molecular formula C20H22F5N3O2S and a molecular weight of 463.47 g/mol. Its IUPAC name is 2-(2-methylsulfanylethyl)-8-(2,3,4,5,6-pentafluorobenzoyl)-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 2-(2-methylsulfanylethyl)-8-(2,3,4,5,6-pentafluorobenzoyl)-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 87293730 |
| Molecular Formula | C20H22F5N3O2S |
| Molecular Weight | 463.47 g/mol |
| Exact Mass | 463.14 |
| IUPAC Name | 2-(2-methylsulfanylethyl)-8-(2,3,4,5,6-pentafluorobenzoyl)-4-prop-2-enyl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | C=CCN1C(=O)C(CCSC)NC12CCN(C(=O)c1c(F)c(F)c(F)c(F)c1F)CC2 |
| InChI | InChI=1S/C20H22F5N3O2S/c1-3-7-28-18(29)11(4-10-31-2)26-20(28)5-8-27(9-6-20)19(30)12-13(21)15(23)17(25)16(24)14(12)22/h3,11,26H,1,4-10H2,2H3 |
| InChIKey | GUGPPELKNDGVJF-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.47 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|