C23H27ClN4O2 — CID 87293769
4-benzyl-8-(2-chloropyridine-3-carbonyl)-2-propan-2-yl-1,4,8-triazaspiro[4.5]decan-3-one (PubChem CID 87293769) has the molecular formula C23H27ClN4O2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 4-benzyl-8-(2-chloropyridine-3-carbonyl)-2-propan-2-yl-1,4,8-triazaspiro[4.5]decan-3-one.
| Compound Name | 4-benzyl-8-(2-chloropyridine-3-carbonyl)-2-propan-2-yl-1,4,8-triazaspiro[4.5]decan-3-one |
|---|---|
| PubChem CID | 87293769 |
| Molecular Formula | C23H27ClN4O2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.18 |
| IUPAC Name | 4-benzyl-8-(2-chloropyridine-3-carbonyl)-2-propan-2-yl-1,4,8-triazaspiro[4.5]decan-3-one |
| SMILES | CC(C)C1NC2(CCN(C(=O)c3cccnc3Cl)CC2)N(Cc2ccccc2)C1=O |
| InChI | InChI=1S/C23H27ClN4O2/c1-16(2)19-22(30)28(15-17-7-4-3-5-8-17)23(26-19)10-13-27(14-11-23)21(29)18-9-6-12-25-20(18)24/h3-9,12,16,19,26H,10-11,13-15H2,1-2H3 |
| InChIKey | OJFIFYYNGXSYLW-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|