C11H23NO5 — CID 87294023
(2S)-2,3,3,4,5,5,5-heptadeuterio-4-(deuteriomethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate (PubChem CID 87294023) has the molecular formula C11H23NO5 and a molecular weight of 257.36 g/mol. Its IUPAC name is (2S)-2,3,3,4,5,5,5-heptadeuterio-4-(deuteriomethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate.
| Compound Name | (2S)-2,3,3,4,5,5,5-heptadeuterio-4-(deuteriomethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
|---|---|
| PubChem CID | 87294023 |
| Molecular Formula | C11H23NO5 |
| Molecular Weight | 257.36 g/mol |
| Exact Mass | 257.21 |
| IUPAC Name | (2S)-2,3,3,4,5,5,5-heptadeuterio-4-(deuteriomethyl)-2-[(2-methylpropan-2-yl)oxycarbonylamino]pentanoic acid;hydrate |
| SMILES | O.[2H]CC([2H])(C([2H])([2H])[2H])C([2H])([2H])[C@]([2H])(NC(=O)OC(C)(C)C)C(=O)O |
| InChI | InChI=1S/C11H21NO4.H2O/c1-7(2)6-8(9(13)14)12-10(15)16-11(3,4)5;/h7-8H,6H2,1-5H3,(H,12,15)(H,13,14);1H2/t8-;/m0./s1/i1D,2D3,6D2,7D,8D;/t7?,8-; |
| InChIKey | URQQEIOTRWJXBA-LRJKHVITSA-N |
| XLogP | 1.19 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.36 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |