About 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid
5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid (PubChem CID 87294087) has the molecular formula C9H12O7S2
and a molecular weight of 296.32 g/mol. Its IUPAC name is 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid.
Molecular Properties
| Compound Name | 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid |
| PubChem CID | 87294087 |
| Molecular Formula | C9H12O7S2 |
| Molecular Weight | 296.32 g/mol |
| Exact Mass | 296.00 |
| IUPAC Name | 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid |
| SMILES | Cc1c(S(=O)(=O)O)cc(CCO)cc1S(=O)(=O)O |
| InChI | InChI=1S/C9H12O7S2/c1-6-8(17(11,12)13)4-7(2-3-10)5-9(6)18(14,15)16/h4-5,10H,2-3H2,1H3,(H,11,12,13)(H,14,15,16) |
| InChIKey | IWZJKLWSIZODJA-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 128.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.32 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid?
The IUPAC name of 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid (CID 87294087) is 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid.
What is the SMILES notation for 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid?
The canonical SMILES for 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid is Cc1c(S(=O)(=O)O)cc(CCO)cc1S(=O)(=O)O.
What is the InChIKey of 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid?
The InChIKey is IWZJKLWSIZODJA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12O7S2/c1-6-8(17(11,12)13)4-7(2-3-10)5-9(6)18(14,15)16/h4-5,10H,2-3H2,1H3,(H,11,12,13)(H,14,15,16).
What are the key properties of 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid?
5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid has a molecular weight of 296.32 g/mol, XLogP of 0.02, 4 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(2-hydroxyethyl)-2-methylbenzene-1,3-disulfonic acid is sourced from PubChem (CID 87294087), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).