About 3-(3-bromophenyl)-2,2-dimethyloxirane
3-(3-bromophenyl)-2,2-dimethyloxirane (PubChem CID 87295088) has the molecular formula C10H11BrO
and a molecular weight of 227.10 g/mol. Its IUPAC name is 3-(3-bromophenyl)-2,2-dimethyloxirane.
Molecular Properties
| Compound Name | 3-(3-bromophenyl)-2,2-dimethyloxirane |
| PubChem CID | 87295088 |
| Molecular Formula | C10H11BrO |
| Molecular Weight | 227.10 g/mol |
| Exact Mass | 226.00 |
| IUPAC Name | 3-(3-bromophenyl)-2,2-dimethyloxirane |
| SMILES | CC1(C)OC1c1cccc(Br)c1 |
| InChI | InChI=1S/C10H11BrO/c1-10(2)9(12-10)7-4-3-5-8(11)6-7/h3-6,9H,1-2H3 |
| InChIKey | UQOWSXVSJBDRNC-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 12.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 227.10 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|
Analyze 3-(3-bromophenyl)-2,2-dimethyloxirane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(3-bromophenyl)-2,2-dimethyloxirane?
The IUPAC name of 3-(3-bromophenyl)-2,2-dimethyloxirane (CID 87295088) is 3-(3-bromophenyl)-2,2-dimethyloxirane.
What is the SMILES notation for 3-(3-bromophenyl)-2,2-dimethyloxirane?
The canonical SMILES for 3-(3-bromophenyl)-2,2-dimethyloxirane is CC1(C)OC1c1cccc(Br)c1.
What is the InChIKey of 3-(3-bromophenyl)-2,2-dimethyloxirane?
The InChIKey is UQOWSXVSJBDRNC-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H11BrO/c1-10(2)9(12-10)7-4-3-5-8(11)6-7/h3-6,9H,1-2H3.
What are the key properties of 3-(3-bromophenyl)-2,2-dimethyloxirane?
3-(3-bromophenyl)-2,2-dimethyloxirane has a molecular weight of 227.10 g/mol, XLogP of 3.30, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(3-bromophenyl)-2,2-dimethyloxirane is sourced from PubChem (CID 87295088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).