About 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one
6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one (PubChem CID 87295149) has the molecular formula C9H9BrN2O2
and a molecular weight of 257.09 g/mol. Its IUPAC name is 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one.
Molecular Properties
| Compound Name | 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one |
| PubChem CID | 87295149 |
| Molecular Formula | C9H9BrN2O2 |
| Molecular Weight | 257.09 g/mol |
| Exact Mass | 255.98 |
| IUPAC Name | 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one |
| SMILES | CC1(C)Nc2ccc(Br)nc2OC1=O |
| InChI | InChI=1S/C9H9BrN2O2/c1-9(2)8(13)14-7-5(12-9)3-4-6(10)11-7/h3-4,12H,1-2H3 |
| InChIKey | HSKWKIWHFYBCIA-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 51.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.09 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one?
The IUPAC name of 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one (CID 87295149) is 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one.
What is the SMILES notation for 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one?
The canonical SMILES for 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one is CC1(C)Nc2ccc(Br)nc2OC1=O.
What is the InChIKey of 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one?
The InChIKey is HSKWKIWHFYBCIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H9BrN2O2/c1-9(2)8(13)14-7-5(12-9)3-4-6(10)11-7/h3-4,12H,1-2H3.
What are the key properties of 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one?
6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one has a molecular weight of 257.09 g/mol, XLogP of 1.95, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromo-2,2-dimethyl-1H-pyrido[2,3-b][1,4]oxazin-3-one is sourced from PubChem (CID 87295149), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).