C19H27NO4 — CID 87295900
(2R,4S,5R)-6-oxido-5-(6-phenylmethoxyhexyl)-3,7-dioxa-6-azoniatricyclo[4.3.0.02,4]nonane (PubChem CID 87295900) has the molecular formula C19H27NO4 and a molecular weight of 333.43 g/mol. Its IUPAC name is (2R,4S,5R)-6-oxido-5-(6-phenylmethoxyhexyl)-3,7-dioxa-6-azoniatricyclo[4.3.0.02,4]nonane.
| Compound Name | (2R,4S,5R)-6-oxido-5-(6-phenylmethoxyhexyl)-3,7-dioxa-6-azoniatricyclo[4.3.0.02,4]nonane |
|---|---|
| PubChem CID | 87295900 |
| Molecular Formula | C19H27NO4 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.19 |
| IUPAC Name | (2R,4S,5R)-6-oxido-5-(6-phenylmethoxyhexyl)-3,7-dioxa-6-azoniatricyclo[4.3.0.02,4]nonane |
| SMILES | [O-][N+]12OCCC1[C@H]1O[C@H]1[C@H]2CCCCCCOCc1ccccc1 |
| InChI | InChI=1S/C19H27NO4/c21-20-16(18-19(24-18)17(20)11-13-23-20)10-6-1-2-7-12-22-14-15-8-4-3-5-9-15/h3-5,8-9,16-19H,1-2,6-7,10-14H2/t16-,17?,18+,19-,20?/m1/s1 |
| InChIKey | YMXKCFAEDLVBBO-KBKAQKEBSA-N |
| XLogP | 3.32 |
| TPSA | 54.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|