C16H34O6 — CID 87295984
2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-(3-methoxyprop-1-en-2-yloxy)hexane (PubChem CID 87295984) has the molecular formula C16H34O6 and a molecular weight of 322.44 g/mol. Its IUPAC name is 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-(3-methoxyprop-1-en-2-yloxy)hexane.
| Compound Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-(3-methoxyprop-1-en-2-yloxy)hexane |
|---|---|
| PubChem CID | 87295984 |
| Molecular Formula | C16H34O6 |
| Molecular Weight | 322.44 g/mol |
| Exact Mass | 322.24 |
| IUPAC Name | 2-[2-(2-hydroxyethoxy)ethoxy]ethanol;1-(3-methoxyprop-1-en-2-yloxy)hexane |
| SMILES | C=C(COC)OCCCCCC.OCCOCCOCCO |
| InChI | InChI=1S/C10H20O2.C6H14O4/c1-4-5-6-7-8-12-10(2)9-11-3;7-1-3-9-5-6-10-4-2-8/h2,4-9H2,1,3H3;7-8H,1-6H2 |
| InChIKey | JSGVPRDVMVDRFX-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.44 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|