C20H14ClN3O3S — CID 87296110
4-[4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dihydro-1,4-benzoxazin-6-yl]benzonitrile (PubChem CID 87296110) has the molecular formula C20H14ClN3O3S and a molecular weight of 411.87 g/mol. Its IUPAC name is 4-[4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dihydro-1,4-benzoxazin-6-yl]benzonitrile.
| Compound Name | 4-[4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dihydro-1,4-benzoxazin-6-yl]benzonitrile |
|---|---|
| PubChem CID | 87296110 |
| Molecular Formula | C20H14ClN3O3S |
| Molecular Weight | 411.87 g/mol |
| Exact Mass | 411.04 |
| IUPAC Name | 4-[4-[(6-chloro-3-pyridinyl)sulfonyl]-2,3-dihydro-1,4-benzoxazin-6-yl]benzonitrile |
| SMILES | N#Cc1ccc(-c2ccc3c(c2)N(S(=O)(=O)c2ccc(Cl)nc2)CCO3)cc1 |
| InChI | InChI=1S/C20H14ClN3O3S/c21-20-8-6-17(13-23-20)28(25,26)24-9-10-27-19-7-5-16(11-18(19)24)15-3-1-14(12-22)2-4-15/h1-8,11,13H,9-10H2 |
| InChIKey | HTBJZELNCKUGPO-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 83.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.87 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|