C14H20N2O2S2 — CID 87296582
N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)sulfanyl]-N,2-dimethylpropan-2-amine (PubChem CID 87296582) has the molecular formula C14H20N2O2S2 and a molecular weight of 312.46 g/mol. Its IUPAC name is N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)sulfanyl]-N,2-dimethylpropan-2-amine.
| Compound Name | N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)sulfanyl]-N,2-dimethylpropan-2-amine |
|---|---|
| PubChem CID | 87296582 |
| Molecular Formula | C14H20N2O2S2 |
| Molecular Weight | 312.46 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | N-[(4,6-dimethoxy-1,3-benzothiazol-2-yl)sulfanyl]-N,2-dimethylpropan-2-amine |
| SMILES | COc1cc(OC)c2nc(SN(C)C(C)(C)C)sc2c1 |
| InChI | InChI=1S/C14H20N2O2S2/c1-14(2,3)16(4)20-13-15-12-10(18-6)7-9(17-5)8-11(12)19-13/h7-8H,1-6H3 |
| InChIKey | PCFXKXXWYGNMRL-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 34.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.46 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|