C17H17BF3N3O5S — CID 87296786
N-[2-(3-aminophenyl)-1-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]ethyl]-2,2,2-trifluoroacetamide (PubChem CID 87296786) has the molecular formula C17H17BF3N3O5S and a molecular weight of 443.21 g/mol. Its IUPAC name is N-[2-(3-aminophenyl)-1-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]ethyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[2-(3-aminophenyl)-1-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]ethyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 87296786 |
| Molecular Formula | C17H17BF3N3O5S |
| Molecular Weight | 443.21 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | N-[2-(3-aminophenyl)-1-[(1-hydroxy-3H-2,1-benzoxaborol-6-yl)sulfamoyl]ethyl]-2,2,2-trifluoroacetamide |
| SMILES | Nc1cccc(CC(NC(=O)C(F)(F)F)S(=O)(=O)Nc2ccc3c(c2)B(O)OC3)c1 |
| InChI | InChI=1S/C17H17BF3N3O5S/c19-17(20,21)16(25)23-15(7-10-2-1-3-12(22)6-10)30(27,28)24-13-5-4-11-9-29-18(26)14(11)8-13/h1-6,8,15,24,26H,7,9,22H2,(H,23,25) |
| InChIKey | PADXSZGFWXVPKE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 130.75 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.21 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|