C18H22FN2O2+ — CID 8729750
2-(2-fluorophenoxy)ethyl-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium (PubChem CID 8729750) has the molecular formula C18H22FN2O2+ and a molecular weight of 317.38 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium.
| Compound Name | 2-(2-fluorophenoxy)ethyl-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
|---|---|
| PubChem CID | 8729750 |
| Molecular Formula | C18H22FN2O2+ |
| Molecular Weight | 317.38 g/mol |
| Exact Mass | 317.17 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl-methyl-[2-(4-methylanilino)-2-oxoethyl]azanium |
| SMILES | Cc1ccc(NC(=O)C[NH+](C)CCOc2ccccc2F)cc1 |
| InChI | InChI=1S/C18H21FN2O2/c1-14-7-9-15(10-8-14)20-18(22)13-21(2)11-12-23-17-6-4-3-5-16(17)19/h3-10H,11-13H2,1-2H3,(H,20,22)/p+1 |
| InChIKey | GFWWTIHOLQVFDD-UHFFFAOYSA-O |
| XLogP | 1.67 |
| TPSA | 42.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.38 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |