About 1-formyloxyethyl 3-methylimidazole-4-carboxylate
1-formyloxyethyl 3-methylimidazole-4-carboxylate (PubChem CID 87297635) has the molecular formula C8H10N2O4
and a molecular weight of 198.18 g/mol. Its IUPAC name is 1-formyloxyethyl 3-methylimidazole-4-carboxylate.
Molecular Properties
| Compound Name | 1-formyloxyethyl 3-methylimidazole-4-carboxylate |
| PubChem CID | 87297635 |
| Molecular Formula | C8H10N2O4 |
| Molecular Weight | 198.18 g/mol |
| Exact Mass | 198.06 |
| IUPAC Name | 1-formyloxyethyl 3-methylimidazole-4-carboxylate |
| SMILES | CC(OC=O)OC(=O)c1cncn1C |
| InChI | InChI=1S/C8H10N2O4/c1-6(13-5-11)14-8(12)7-3-9-4-10(7)2/h3-6H,1-2H3 |
| InChIKey | HVYFSUVTOGKEOD-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.18 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze 1-formyloxyethyl 3-methylimidazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-formyloxyethyl 3-methylimidazole-4-carboxylate?
The IUPAC name of 1-formyloxyethyl 3-methylimidazole-4-carboxylate (CID 87297635) is 1-formyloxyethyl 3-methylimidazole-4-carboxylate.
What is the SMILES notation for 1-formyloxyethyl 3-methylimidazole-4-carboxylate?
The canonical SMILES for 1-formyloxyethyl 3-methylimidazole-4-carboxylate is CC(OC=O)OC(=O)c1cncn1C.
What is the InChIKey of 1-formyloxyethyl 3-methylimidazole-4-carboxylate?
The InChIKey is HVYFSUVTOGKEOD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O4/c1-6(13-5-11)14-8(12)7-3-9-4-10(7)2/h3-6H,1-2H3.
What are the key properties of 1-formyloxyethyl 3-methylimidazole-4-carboxylate?
1-formyloxyethyl 3-methylimidazole-4-carboxylate has a molecular weight of 198.18 g/mol, XLogP of 0.10, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-formyloxyethyl 3-methylimidazole-4-carboxylate is sourced from PubChem (CID 87297635), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).