About formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate
formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate (PubChem CID 87297781) has the molecular formula C9H14O7
and a molecular weight of 234.20 g/mol. Its IUPAC name is formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate.
Molecular Properties
| Compound Name | formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate |
| PubChem CID | 87297781 |
| Molecular Formula | C9H14O7 |
| Molecular Weight | 234.20 g/mol |
| Exact Mass | 234.07 |
| IUPAC Name | formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate |
| SMILES | COC=O.O=COCOC(=O)C1(CO)CC1 |
| InChI | InChI=1S/C7H10O5.C2H4O2/c8-3-7(1-2-7)6(10)12-5-11-4-9;1-4-2-3/h4,8H,1-3,5H2;2H,1H3 |
| InChIKey | VXSFKHCFFRILIV-UHFFFAOYSA-N |
| XLogP | -0.78 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.20 |
| LogP ≤ 5 | -0.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate?
The IUPAC name of formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate (CID 87297781) is formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate.
What is the SMILES notation for formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate?
The canonical SMILES for formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate is COC=O.O=COCOC(=O)C1(CO)CC1.
What is the InChIKey of formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate?
The InChIKey is VXSFKHCFFRILIV-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10O5.C2H4O2/c8-3-7(1-2-7)6(10)12-5-11-4-9;1-4-2-3/h4,8H,1-3,5H2;2H,1H3.
What are the key properties of formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate?
formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate has a molecular weight of 234.20 g/mol, XLogP of -0.78, 6 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for formyloxymethyl 1-(hydroxymethyl)cyclopropane-1-carboxylate;methyl formate is sourced from PubChem (CID 87297781), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).