About butyl-ethylsilanol
butyl-ethylsilanol (PubChem CID 87298682) has the molecular formula C6H15OSi
and a molecular weight of 131.27 g/mol.
Molecular Properties
| Compound Name | butyl-ethylsilanol |
| PubChem CID | 87298682 |
| Molecular Formula | C6H15OSi |
| Molecular Weight | 131.27 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | — |
| SMILES | CCCC[Si](O)CC |
| InChI | InChI=1S/C6H15OSi/c1-3-5-6-8(7)4-2/h7H,3-6H2,1-2H3 |
| InChIKey | AESCUZZJMDDYPY-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.27 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze butyl-ethylsilanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of butyl-ethylsilanol?
The IUPAC name of butyl-ethylsilanol (CID 87298682) is not available.
What is the SMILES notation for butyl-ethylsilanol?
The canonical SMILES for butyl-ethylsilanol is CCCC[Si](O)CC.
What is the InChIKey of butyl-ethylsilanol?
The InChIKey is AESCUZZJMDDYPY-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H15OSi/c1-3-5-6-8(7)4-2/h7H,3-6H2,1-2H3.
What are the key properties of butyl-ethylsilanol?
butyl-ethylsilanol has a molecular weight of 131.27 g/mol, XLogP of 1.79, 4 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for butyl-ethylsilanol is sourced from PubChem (CID 87298682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).