About methanesulfonate;1H-pyrazol-1-ium
methanesulfonate;1H-pyrazol-1-ium (PubChem CID 87298761) has the molecular formula C4H8N2O3S
and a molecular weight of 164.19 g/mol. Its IUPAC name is methanesulfonate;1H-pyrazol-1-ium.
Molecular Properties
| Compound Name | methanesulfonate;1H-pyrazol-1-ium |
| PubChem CID | 87298761 |
| Molecular Formula | C4H8N2O3S |
| Molecular Weight | 164.19 g/mol |
| Exact Mass | 164.03 |
| IUPAC Name | methanesulfonate;1H-pyrazol-1-ium |
| SMILES | C1=C[NH2+]N=C1.CS(=O)(=O)[O-] |
| InChI | InChI=1S/C3H4N2.CH4O3S/c1-2-4-5-3-1;1-5(2,3)4/h1-3H,(H,4,5);1H3,(H,2,3,4) |
| InChIKey | CMUYAPPMAUVUBN-UHFFFAOYSA-N |
| XLogP | -1.78 |
| TPSA | 86.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.19 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze methanesulfonate;1H-pyrazol-1-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methanesulfonate;1H-pyrazol-1-ium?
The IUPAC name of methanesulfonate;1H-pyrazol-1-ium (CID 87298761) is methanesulfonate;1H-pyrazol-1-ium.
What is the SMILES notation for methanesulfonate;1H-pyrazol-1-ium?
The canonical SMILES for methanesulfonate;1H-pyrazol-1-ium is C1=C[NH2+]N=C1.CS(=O)(=O)[O-].
What is the InChIKey of methanesulfonate;1H-pyrazol-1-ium?
The InChIKey is CMUYAPPMAUVUBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H4N2.CH4O3S/c1-2-4-5-3-1;1-5(2,3)4/h1-3H,(H,4,5);1H3,(H,2,3,4).
What are the key properties of methanesulfonate;1H-pyrazol-1-ium?
methanesulfonate;1H-pyrazol-1-ium has a molecular weight of 164.19 g/mol, XLogP of -1.78, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methanesulfonate;1H-pyrazol-1-ium is sourced from PubChem (CID 87298761), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).