C35H33F5O7S2 — CID 87298885
[1-[diphenyl-(4-prop-2-enoyloxyphenyl)-λ4-sulfanyl]oxysulfonyl-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate (PubChem CID 87298885) has the molecular formula C35H33F5O7S2 and a molecular weight of 724.77 g/mol. Its IUPAC name is [1-[diphenyl-(4-prop-2-enoyloxyphenyl)-λ4-sulfanyl]oxysulfonyl-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate.
| Compound Name | [1-[diphenyl-(4-prop-2-enoyloxyphenyl)-λ4-sulfanyl]oxysulfonyl-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate |
|---|---|
| PubChem CID | 87298885 |
| Molecular Formula | C35H33F5O7S2 |
| Molecular Weight | 724.77 g/mol |
| Exact Mass | 724.16 |
| IUPAC Name | [1-[diphenyl-(4-prop-2-enoyloxyphenyl)-λ4-sulfanyl]oxysulfonyl-1,1,3,3,3-pentafluoropropan-2-yl] adamantane-1-carboxylate |
| SMILES | C=CC(=O)Oc1ccc(S(OS(=O)(=O)C(F)(F)C(OC(=O)C23CC4CC(CC(C4)C2)C3)C(F)(F)F)(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C35H33F5O7S2/c1-2-30(41)45-26-13-15-29(16-14-26)48(27-9-5-3-6-10-27,28-11-7-4-8-12-28)47-49(43,44)35(39,40)31(34(36,37)38)46-32(42)33-20-23-17-24(21-33)19-25(18-23)22-33/h2-16,23-25,31H,1,17-22H2 |
| InChIKey | ZJVKVPCVNSUQFY-UHFFFAOYSA-N |
| XLogP | 8.60 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 724.77 |
| LogP ≤ 5 | 8.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|