1-aminoethanol;trifluoromethanesulfonic acid

C3H8F3NO4S — CID 87298984

IUPAC1-aminoethanol;trifluoromethanesulfonic acid
SMILESCC(N)O.O=S(=O)(O)C(F)(F)F
InChIInChI=1S/C2H7NO.CHF3O3S/c1-2(3)4;2-1(3,4)8(5,6)7/h2,4H,3H2,1H3;(H,5,6,7)
InChIKeyHWPHCRNCAFZVRL-UHFFFAOYSA-N
MW211.16 g/mol
LogP-0.32
Rot. Bonds

About 1-aminoethanol;trifluoromethanesulfonic acid

1-aminoethanol;trifluoromethanesulfonic acid (PubChem CID 87298984) has the molecular formula C3H8F3NO4S and a molecular weight of 211.16 g/mol. Its IUPAC name is 1-aminoethanol;trifluoromethanesulfonic acid.

Molecular Properties

Compound Name1-aminoethanol;trifluoromethanesulfonic acid
PubChem CID87298984
Molecular FormulaC3H8F3NO4S
Molecular Weight211.16 g/mol
Exact Mass211.01
IUPAC Name1-aminoethanol;trifluoromethanesulfonic acid
SMILESCC(N)O.O=S(=O)(O)C(F)(F)F
InChIInChI=1S/C2H7NO.CHF3O3S/c1-2(3)4;2-1(3,4)8(5,6)7/h2,4H,3H2,1H3;(H,5,6,7)
InChIKeyHWPHCRNCAFZVRL-UHFFFAOYSA-N
XLogP-0.32
TPSA100.62 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds
Heavy Atoms12
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500211.16
LogP ≤ 5-0.32
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'}

Analyze 1-aminoethanol;trifluoromethanesulfonic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-aminoethanol;trifluoromethanesulfonic acid?
The IUPAC name of 1-aminoethanol;trifluoromethanesulfonic acid (CID 87298984) is 1-aminoethanol;trifluoromethanesulfonic acid.
What is the SMILES notation for 1-aminoethanol;trifluoromethanesulfonic acid?
The canonical SMILES for 1-aminoethanol;trifluoromethanesulfonic acid is CC(N)O.O=S(=O)(O)C(F)(F)F.
What is the InChIKey of 1-aminoethanol;trifluoromethanesulfonic acid?
The InChIKey is HWPHCRNCAFZVRL-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H7NO.CHF3O3S/c1-2(3)4;2-1(3,4)8(5,6)7/h2,4H,3H2,1H3;(H,5,6,7).
What are the key properties of 1-aminoethanol;trifluoromethanesulfonic acid?
1-aminoethanol;trifluoromethanesulfonic acid has a molecular weight of 211.16 g/mol, XLogP of -0.32, 0 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoethanol;trifluoromethanesulfonic acid is sourced from PubChem (CID 87298984), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).