About 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine
6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine (PubChem CID 87298995) has the molecular formula C12H10F6N4
and a molecular weight of 324.23 g/mol. Its IUPAC name is 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine.
Molecular Properties
| Compound Name | 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine |
| PubChem CID | 87298995 |
| Molecular Formula | C12H10F6N4 |
| Molecular Weight | 324.23 g/mol |
| Exact Mass | 324.08 |
| IUPAC Name | 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine |
| SMILES | Cc1cc(Cn2nc(C(F)(F)F)cc2C(F)(F)F)ncc1N |
| InChI | InChI=1S/C12H10F6N4/c1-6-2-7(20-4-8(6)19)5-22-10(12(16,17)18)3-9(21-22)11(13,14)15/h2-4H,5,19H2,1H3 |
| InChIKey | SANLIEMNEJXWTP-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.23 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine?
The IUPAC name of 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine (CID 87298995) is 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine.
What is the SMILES notation for 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine?
The canonical SMILES for 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine is Cc1cc(Cn2nc(C(F)(F)F)cc2C(F)(F)F)ncc1N.
What is the InChIKey of 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine?
The InChIKey is SANLIEMNEJXWTP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H10F6N4/c1-6-2-7(20-4-8(6)19)5-22-10(12(16,17)18)3-9(21-22)11(13,14)15/h2-4H,5,19H2,1H3.
What are the key properties of 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine?
6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine has a molecular weight of 324.23 g/mol, XLogP of 3.25, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-[[3,5-bis(trifluoromethyl)pyrazol-1-yl]methyl]-4-methylpyridin-3-amine is sourced from PubChem (CID 87298995), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).